C24H29F3N8 — CID 149043613
7-[1-amino-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 149043613) has the molecular formula C24H29F3N8 and a molecular weight of 486.55 g/mol. Its IUPAC name is 7-[1-amino-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 7-[1-amino-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 149043613 |
| Molecular Formula | C24H29F3N8 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 7-[1-amino-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)c1cnnc(Nc2ccc3ncc(C(=CN)/C=N/CCCN(C)CC(F)(F)F)cc3n2)c1 |
| InChI | InChI=1S/C24H29F3N8/c1-16(2)17-10-23(34-31-14-17)33-22-6-5-20-21(32-22)9-18(13-30-20)19(11-28)12-29-7-4-8-35(3)15-24(25,26)27/h5-6,9-14,16H,4,7-8,15,28H2,1-3H3,(H,32,33,34)/b19-11?,29-12+ |
| InChIKey | SHVFEZLJOQZPPJ-FKEJLRKJSA-N |
| XLogP | 4.54 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|