About (2R)-N'-ethyl-2-methylpentanimidamide
(2R)-N'-ethyl-2-methylpentanimidamide (PubChem CID 149048954) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (2R)-N'-ethyl-2-methylpentanimidamide.
Molecular Properties
| Compound Name | (2R)-N'-ethyl-2-methylpentanimidamide |
| PubChem CID | 149048954 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (2R)-N'-ethyl-2-methylpentanimidamide |
| SMILES | CCC[C@@H](C)/C(N)=N/CC |
| InChI | InChI=1S/C8H18N2/c1-4-6-7(3)8(9)10-5-2/h7H,4-6H2,1-3H3,(H2,9,10)/t7-/m1/s1 |
| InChIKey | QJKWJAPJEOCKEF-SSDOTTSWSA-N |
| XLogP | 1.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N'-ethyl-2-methylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N'-ethyl-2-methylpentanimidamide?
The IUPAC name of (2R)-N'-ethyl-2-methylpentanimidamide (CID 149048954) is (2R)-N'-ethyl-2-methylpentanimidamide.
What is the SMILES notation for (2R)-N'-ethyl-2-methylpentanimidamide?
The canonical SMILES for (2R)-N'-ethyl-2-methylpentanimidamide is CCC[C@@H](C)/C(N)=N/CC.
What is the InChIKey of (2R)-N'-ethyl-2-methylpentanimidamide?
The InChIKey is QJKWJAPJEOCKEF-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H18N2/c1-4-6-7(3)8(9)10-5-2/h7H,4-6H2,1-3H3,(H2,9,10)/t7-/m1/s1.
What are the key properties of (2R)-N'-ethyl-2-methylpentanimidamide?
(2R)-N'-ethyl-2-methylpentanimidamide has a molecular weight of 142.25 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N'-ethyl-2-methylpentanimidamide is sourced from PubChem (CID 149048954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).