C29H25N3O2 — CID 149049477
1-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]acetyl]phenyl]but-3-en-2-one (PubChem CID 149049477) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]acetyl]phenyl]but-3-en-2-one.
| Compound Name | 1-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]acetyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 149049477 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]acetyl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccc(C(=O)Cc2ccc(C)c(Cc3nccc(-c4cccnc4)n3)c2)cc1 |
| InChI | InChI=1S/C29H25N3O2/c1-3-26(33)16-21-8-10-23(11-9-21)28(34)17-22-7-6-20(2)25(15-22)18-29-31-14-12-27(32-29)24-5-4-13-30-19-24/h3-15,19H,1,16-18H2,2H3 |
| InChIKey | QJNJOLGQYKPNDJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|