About CID 149049620
CID 149049620 (PubChem CID 149049620) has the molecular formula C14H8IO2-
and a molecular weight of 335.12 g/mol.
Molecular Properties
| Compound Name | CID 149049620 |
| PubChem CID | 149049620 |
| Molecular Formula | C14H8IO2- |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | — |
| SMILES | O=C1[I-]C(=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H8IO2/c16-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)15-13/h1-8H/q-1 |
| InChIKey | OWNWWRDWPJOTQS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 149049620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149049620?
The IUPAC name of CID 149049620 (CID 149049620) is not available.
What is the SMILES notation for CID 149049620?
The canonical SMILES for CID 149049620 is O=C1[I-]C(=O)c2ccccc2-c2ccccc21.
What is the InChIKey of CID 149049620?
The InChIKey is OWNWWRDWPJOTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8IO2/c16-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)15-13/h1-8H/q-1.
What are the key properties of CID 149049620?
CID 149049620 has a molecular weight of 335.12 g/mol, XLogP of -0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149049620 is sourced from PubChem (CID 149049620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).