About 1-iodo-2,4-dinitrosobenzene
1-iodo-2,4-dinitrosobenzene (PubChem CID 149052807) has the molecular formula C6H3IN2O2
and a molecular weight of 262.01 g/mol. Its IUPAC name is 1-iodo-2,4-dinitrosobenzene.
Molecular Properties
| Compound Name | 1-iodo-2,4-dinitrosobenzene |
| PubChem CID | 149052807 |
| Molecular Formula | C6H3IN2O2 |
| Molecular Weight | 262.01 g/mol |
| Exact Mass | 261.92 |
| IUPAC Name | 1-iodo-2,4-dinitrosobenzene |
| SMILES | O=Nc1ccc(I)c(N=O)c1 |
| InChI | InChI=1S/C6H3IN2O2/c7-5-2-1-4(8-10)3-6(5)9-11/h1-3H |
| InChIKey | QKDLPPWLONNVPC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.01 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2,4-dinitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2,4-dinitrosobenzene?
The IUPAC name of 1-iodo-2,4-dinitrosobenzene (CID 149052807) is 1-iodo-2,4-dinitrosobenzene.
What is the SMILES notation for 1-iodo-2,4-dinitrosobenzene?
The canonical SMILES for 1-iodo-2,4-dinitrosobenzene is O=Nc1ccc(I)c(N=O)c1.
What is the InChIKey of 1-iodo-2,4-dinitrosobenzene?
The InChIKey is QKDLPPWLONNVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3IN2O2/c7-5-2-1-4(8-10)3-6(5)9-11/h1-3H.
What are the key properties of 1-iodo-2,4-dinitrosobenzene?
1-iodo-2,4-dinitrosobenzene has a molecular weight of 262.01 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2,4-dinitrosobenzene is sourced from PubChem (CID 149052807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).