C16H18BrN3 — CID 14905314
(1R,7S)-4-(6-bromo-2-pyridinyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene (PubChem CID 14905314) has the molecular formula C16H18BrN3 and a molecular weight of 332.25 g/mol. Its IUPAC name is (1R,7S)-4-(6-bromo-2-pyridinyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene.
| Compound Name | (1R,7S)-4-(6-bromo-2-pyridinyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene |
|---|---|
| PubChem CID | 14905314 |
| Molecular Formula | C16H18BrN3 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (1R,7S)-4-(6-bromo-2-pyridinyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nn(-c3cccc(Br)n3)cc12 |
| InChI | InChI=1S/C16H18BrN3/c1-15(2)11-7-8-16(15,3)14-10(11)9-20(19-14)13-6-4-5-12(17)18-13/h4-6,9,11H,7-8H2,1-3H3/t11-,16+/m1/s1 |
| InChIKey | YYDNELWCWZSBKZ-BZNIZROVSA-N |
| XLogP | 4.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|