C26H22N4OS — CID 14905363
2-[(dibenzylamino)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinoline-4-carbaldehyde (PubChem CID 14905363) has the molecular formula C26H22N4OS and a molecular weight of 438.56 g/mol. Its IUPAC name is 2-[(dibenzylamino)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinoline-4-carbaldehyde.
| Compound Name | 2-[(dibenzylamino)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 14905363 |
| Molecular Formula | C26H22N4OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[(dibenzylamino)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinoline-4-carbaldehyde |
| SMILES | O=Cc1cc2ccccc2n2c(=S)n(CN(Cc3ccccc3)Cc3ccccc3)nc12 |
| InChI | InChI=1S/C26H22N4OS/c31-18-23-15-22-13-7-8-14-24(22)30-25(23)27-29(26(30)32)19-28(16-20-9-3-1-4-10-20)17-21-11-5-2-6-12-21/h1-15,18H,16-17,19H2 |
| InChIKey | MNDXHTSSDKYDJB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|