C20H27F2N5O2S3 — CID 149054640
N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]-4-[ethyl(ethylidene)-λ4-sulfanyl]piperazine-1-sulfinamide (PubChem CID 149054640) has the molecular formula C20H27F2N5O2S3 and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]-4-[ethyl(ethylidene)-λ4-sulfanyl]piperazine-1-sulfinamide.
| Compound Name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]-4-[ethyl(ethylidene)-λ4-sulfanyl]piperazine-1-sulfinamide |
|---|---|
| PubChem CID | 149054640 |
| Molecular Formula | C20H27F2N5O2S3 |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]-4-[ethyl(ethylidene)-λ4-sulfanyl]piperazine-1-sulfinamide |
| SMILES | CC=S(CC)N1CCN(S(=O)Nc2cc(OC)nc(SCc3cccc(F)c3F)n2)CC1 |
| InChI | InChI=1S/C20H27F2N5O2S3/c1-4-31(5-2)26-9-11-27(12-10-26)32(28)25-17-13-18(29-3)24-20(23-17)30-14-15-7-6-8-16(21)19(15)22/h4,6-8,13H,5,9-12,14H2,1-3H3,(H,23,24,25) |
| InChIKey | MGMDJJVUYSZHQK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|