C23H34F2N2O — CID 149057365
(2R,3S)-3-amino-4-(3,5-difluoro-5-methylcyclohexa-1,3-dien-1-yl)-1-[[(1S)-7-ethyl-1,2,3,4,6,7-hexahydronaphthalen-1-yl]amino]butan-2-ol (PubChem CID 149057365) has the molecular formula C23H34F2N2O and a molecular weight of 392.53 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3,5-difluoro-5-methylcyclohexa-1,3-dien-1-yl)-1-[[(1S)-7-ethyl-1,2,3,4,6,7-hexahydronaphthalen-1-yl]amino]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-(3,5-difluoro-5-methylcyclohexa-1,3-dien-1-yl)-1-[[(1S)-7-ethyl-1,2,3,4,6,7-hexahydronaphthalen-1-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 149057365 |
| Molecular Formula | C23H34F2N2O |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (2R,3S)-3-amino-4-(3,5-difluoro-5-methylcyclohexa-1,3-dien-1-yl)-1-[[(1S)-7-ethyl-1,2,3,4,6,7-hexahydronaphthalen-1-yl]amino]butan-2-ol |
| SMILES | CCC1C=C2C(=CC1)CCC[C@@H]2NC[C@@H](O)[C@@H](N)CC1=CC(F)=CC(C)(F)C1 |
| InChI | InChI=1S/C23H34F2N2O/c1-3-15-7-8-17-5-4-6-21(19(17)10-15)27-14-22(28)20(26)11-16-9-18(24)13-23(2,25)12-16/h8-10,13,15,20-22,27-28H,3-7,11-12,14,26H2,1-2H3/t15?,20-,21-,22+,23?/m0/s1 |
| InChIKey | QLCJMFFSQUOMJD-AJVOQWOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |