C40H25N5S — CID 149057989
2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-1,3-benzothiazole (PubChem CID 149057989) has the molecular formula C40H25N5S and a molecular weight of 607.74 g/mol. Its IUPAC name is 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 149057989 |
| Molecular Formula | C40H25N5S |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccc(-c6nc7ccccc7s6)cc54)cc3)n2)cc1 |
| InChI | InChI=1S/C40H25N5S/c1-3-11-26(12-4-1)37-42-38(27-13-5-2-6-14-27)44-39(43-37)28-19-22-30(23-20-28)45-34-17-9-7-15-31(34)32-24-21-29(25-35(32)45)40-41-33-16-8-10-18-36(33)46-40/h1-25H |
| InChIKey | QLFGSBPLLZVWCC-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |