C29H31F4N3O7S — CID 149058204
5-[4-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-oxobutyl]-5-(oxolan-2-yl)imidazolidine-2,4-dione (PubChem CID 149058204) has the molecular formula C29H31F4N3O7S and a molecular weight of 641.64 g/mol. Its IUPAC name is 5-[4-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-oxobutyl]-5-(oxolan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[4-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-oxobutyl]-5-(oxolan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 149058204 |
| Molecular Formula | C29H31F4N3O7S |
| Molecular Weight | 641.64 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | 5-[4-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-oxobutyl]-5-(oxolan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(O)(c1ccc2c(c1)CC[C@@H](CC(=O)CCC1(C3CCCO3)NC(=O)NC1=O)N2S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H31F4N3O7S/c1-27(40,29(31,32)33)18-5-11-23-17(15-18)4-8-20(36(23)44(41,42)22-9-6-19(30)7-10-22)16-21(37)12-13-28(24-3-2-14-43-24)25(38)34-26(39)35-28/h5-7,9-11,15,20,24,40H,2-4,8,12-14,16H2,1H3,(H2,34,35,38,39)/t20-,24?,27?,28?/m0/s1 |
| InChIKey | QLGIXPZIINGLMY-OZFFGNQVSA-N |
| XLogP | 3.60 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|