About N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid
N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid (PubChem CID 14906010) has the molecular formula C24H26N2O5
and a molecular weight of 422.48 g/mol. Its IUPAC name is N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid.
Molecular Properties
| Compound Name | N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid |
| PubChem CID | 14906010 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid |
| SMILES | C=C=CCN(C)Cc1cc2cc(OCc3ccccc3)ccc2n1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H24N2O.C2H2O4/c1-4-5-13-23(2)16-20-14-19-15-21(11-12-22(19)24(20)3)25-17-18-9-7-6-8-10-18;3-1(4)2(5)6/h5-12,14-15H,1,13,16-17H2,2-3H3;(H,3,4)(H,5,6) |
| InChIKey | WQSWCKIXEHSNBA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid?
The IUPAC name of N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid (CID 14906010) is N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid.
What is the SMILES notation for N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid?
The canonical SMILES for N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid is C=C=CCN(C)Cc1cc2cc(OCc3ccccc3)ccc2n1C.O=C(O)C(=O)O.
What is the InChIKey of N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid?
The InChIKey is WQSWCKIXEHSNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O.C2H2O4/c1-4-5-13-23(2)16-20-14-19-15-21(11-12-22(19)24(20)3)25-17-18-9-7-6-8-10-18;3-1(4)2(5)6/h5-12,14-15H,1,13,16-17H2,2-3H3;(H,3,4)(H,5,6).
What are the key properties of N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid?
N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid has a molecular weight of 422.48 g/mol, XLogP of 3.69, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1-methyl-5-phenylmethoxyindol-2-yl)methyl]buta-2,3-dien-1-amine;oxalic acid is sourced from PubChem (CID 14906010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).