About prop-2-enyl (Z)-3-chloroprop-2-enoate
prop-2-enyl (Z)-3-chloroprop-2-enoate (PubChem CID 14906234) has the molecular formula C6H7ClO2
and a molecular weight of 146.57 g/mol. Its IUPAC name is prop-2-enyl (Z)-3-chloroprop-2-enoate.
Molecular Properties
| Compound Name | prop-2-enyl (Z)-3-chloroprop-2-enoate |
| PubChem CID | 14906234 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | prop-2-enyl (Z)-3-chloroprop-2-enoate |
| SMILES | C=CCOC(=O)/C=C\Cl |
| InChI | InChI=1S/C6H7ClO2/c1-2-5-9-6(8)3-4-7/h2-4H,1,5H2/b4-3- |
| InChIKey | BGRWVCWWLNHQGH-ARJAWSKDSA-N |
| XLogP | 1.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (Z)-3-chloroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (Z)-3-chloroprop-2-enoate?
The IUPAC name of prop-2-enyl (Z)-3-chloroprop-2-enoate (CID 14906234) is prop-2-enyl (Z)-3-chloroprop-2-enoate.
What is the SMILES notation for prop-2-enyl (Z)-3-chloroprop-2-enoate?
The canonical SMILES for prop-2-enyl (Z)-3-chloroprop-2-enoate is C=CCOC(=O)/C=C\Cl.
What is the InChIKey of prop-2-enyl (Z)-3-chloroprop-2-enoate?
The InChIKey is BGRWVCWWLNHQGH-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H7ClO2/c1-2-5-9-6(8)3-4-7/h2-4H,1,5H2/b4-3-.
What are the key properties of prop-2-enyl (Z)-3-chloroprop-2-enoate?
prop-2-enyl (Z)-3-chloroprop-2-enoate has a molecular weight of 146.57 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (Z)-3-chloroprop-2-enoate is sourced from PubChem (CID 14906234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).