About N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide
N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide (PubChem CID 149063019) has the molecular formula C14H22F2N2
and a molecular weight of 256.34 g/mol. Its IUPAC name is N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide.
Molecular Properties
| Compound Name | N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide |
| PubChem CID | 149063019 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide |
| SMILES | C=C(C)N/C(C=C(C)C)=N/C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H22F2N2/c1-10(2)9-13(17-11(3)4)18-12-5-7-14(15,16)8-6-12/h9,12H,3,5-8H2,1-2,4H3,(H,17,18) |
| InChIKey | QMFIZDOUFCUSND-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide?
The IUPAC name of N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide (CID 149063019) is N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide.
What is the SMILES notation for N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide?
The canonical SMILES for N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide is C=C(C)N/C(C=C(C)C)=N/C1CCC(F)(F)CC1.
What is the InChIKey of N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide?
The InChIKey is QMFIZDOUFCUSND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2/c1-10(2)9-13(17-11(3)4)18-12-5-7-14(15,16)8-6-12/h9,12H,3,5-8H2,1-2,4H3,(H,17,18).
What are the key properties of N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide?
N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide has a molecular weight of 256.34 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,4-difluorocyclohexyl)-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide is sourced from PubChem (CID 149063019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).