C22H26F3N5O6 — CID 149065299
1-[4-[amino-[(Z)-2-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyprop-1-enyl]amino]phenyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 149065299) has the molecular formula C22H26F3N5O6 and a molecular weight of 513.47 g/mol. Its IUPAC name is 1-[4-[amino-[(Z)-2-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyprop-1-enyl]amino]phenyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[amino-[(Z)-2-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyprop-1-enyl]amino]phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 149065299 |
| Molecular Formula | C22H26F3N5O6 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 1-[4-[amino-[(Z)-2-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyprop-1-enyl]amino]phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | N/C(=C\N(N)c1ccc(NC(=O)Nc2ccccc2C(F)(F)F)cc1)COC1OC(CO)C(O)C1O |
| InChI | InChI=1S/C22H26F3N5O6/c23-22(24,25)15-3-1-2-4-16(15)29-21(34)28-13-5-7-14(8-6-13)30(27)9-12(26)11-35-20-19(33)18(32)17(10-31)36-20/h1-9,17-20,31-33H,10-11,26-27H2,(H2,28,29,34)/b12-9- |
| InChIKey | QMQHYTNFAYENKD-XFXZXTDPSA-N |
| XLogP | 1.29 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|