C8H16N3+ — CID 149065720
(5-ethanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)-methylazanium (PubChem CID 149065720) has the molecular formula C8H16N3+ and a molecular weight of 154.24 g/mol. Its IUPAC name is (5-ethanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)-methylazanium.
| Compound Name | (5-ethanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)-methylazanium |
|---|---|
| PubChem CID | 149065720 |
| Molecular Formula | C8H16N3+ |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.13 |
| IUPAC Name | (5-ethanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)-methylazanium |
| SMILES | [H]/N=C(\C)C1=C([NH2+]C)CCNC1 |
| InChI | InChI=1S/C8H15N3/c1-6(9)7-5-11-4-3-8(7)10-2/h9-11H,3-5H2,1-2H3/p+1/b9-6+ |
| InChIKey | QMSKJWKODPCSSB-RMKNXTFCSA-O |
| XLogP | -0.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|