About cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane
cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane (PubChem CID 14906634) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane.
Molecular Properties
| Compound Name | cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane |
|---|
| PubChem CID | 14906634 |
|---|
| Molecular Formula | C10H16 |
|---|
| Molecular Weight | 136.24 g/mol |
|---|
| Exact Mass | 136.13 |
|---|
| IUPAC Name | cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane |
|---|
| SMILES | C=C[C@@H]1CCCC[C@@H]1C=C |
|---|
| InChI | InChI=1S/C10H16/c1-3-9-7-5-6-8-10(9)4-2/h3-4,9-10H,1-2,5-8H2/t9-,10+ |
|---|
| InChIKey | ARKHCBWJALMQJO-AOOOYVTPSA-N |
|---|
| XLogP | 3.16 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane?
The IUPAC name of cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane (CID 14906634) is cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane.
What is the SMILES notation for cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane?
The canonical SMILES for cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane is C=C[C@@H]1CCCC[C@@H]1C=C.
What is the InChIKey of cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane?
The InChIKey is ARKHCBWJALMQJO-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H16/c1-3-9-7-5-6-8-10(9)4-2/h3-4,9-10H,1-2,5-8H2/t9-,10+.
What are the key properties of cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane?
cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane has a molecular weight of 136.24 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-1,2-bis(ethenyl)cyclohexane is sourced from PubChem (CID 14906634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).