C22H26Cl2N8 — CID 149067034
3-cyano-2-(2,6-dichloro-4-pyridinyl)-1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[3,4-b]pyridin-6-yl)methyl]-1-propylguanidine (PubChem CID 149067034) has the molecular formula C22H26Cl2N8 and a molecular weight of 473.41 g/mol. Its IUPAC name is 3-cyano-2-(2,6-dichloro-4-pyridinyl)-1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[3,4-b]pyridin-6-yl)methyl]-1-propylguanidine.
| Compound Name | 3-cyano-2-(2,6-dichloro-4-pyridinyl)-1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[3,4-b]pyridin-6-yl)methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 149067034 |
| Molecular Formula | C22H26Cl2N8 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-cyano-2-(2,6-dichloro-4-pyridinyl)-1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[3,4-b]pyridin-6-yl)methyl]-1-propylguanidine |
| SMILES | CCCN(Cc1cc(C(C)C)c2c(C)nn(C)c2n1)/C(=N/c1cc(Cl)nc(Cl)c1)NC#N |
| InChI | InChI=1S/C22H26Cl2N8/c1-6-7-32(22(26-12-25)28-15-9-18(23)29-19(24)10-15)11-16-8-17(13(2)3)20-14(4)30-31(5)21(20)27-16/h8-10,13H,6-7,11H2,1-5H3,(H,26,28,29) |
| InChIKey | SWMGCYZMDXJMAK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|