C36H33FN2O+2 — CID 149067863
2-fluoro-17-methoxy-35,35-dimethyl-9,24-diazoniaoctacyclo[29.3.1.05,34.06,23.09,14.015,20.024,33.027,32]pentatriaconta-1,3,5(34),9,11,13,15(20),16,18,24(33),25,27(32),28,30-tetradecaene (PubChem CID 149067863) has the molecular formula C36H33FN2O+2 and a molecular weight of 528.67 g/mol. Its IUPAC name is 2-fluoro-17-methoxy-35,35-dimethyl-9,24-diazoniaoctacyclo[29.3.1.05,34.06,23.09,14.015,20.024,33.027,32]pentatriaconta-1,3,5(34),9,11,13,15(20),16,18,24(33),25,27(32),28,30-tetradecaene.
| Compound Name | 2-fluoro-17-methoxy-35,35-dimethyl-9,24-diazoniaoctacyclo[29.3.1.05,34.06,23.09,14.015,20.024,33.027,32]pentatriaconta-1,3,5(34),9,11,13,15(20),16,18,24(33),25,27(32),28,30-tetradecaene |
|---|---|
| PubChem CID | 149067863 |
| Molecular Formula | C36H33FN2O+2 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-fluoro-17-methoxy-35,35-dimethyl-9,24-diazoniaoctacyclo[29.3.1.05,34.06,23.09,14.015,20.024,33.027,32]pentatriaconta-1,3,5(34),9,11,13,15(20),16,18,24(33),25,27(32),28,30-tetradecaene |
| SMILES | COc1ccc2c(c1)-c1cccc[n+]1CCC1c3ccc(F)c4c3-c3c5c(cccc5cc[n+]3C1CC2)C4(C)C |
| InChI | InChI=1S/C36H33FN2O/c1-36(2)28-8-6-7-23-16-20-39-31-15-11-22-10-12-24(40-3)21-27(22)30-9-4-5-18-38(30)19-17-25(31)26-13-14-29(37)34(36)33(26)35(39)32(23)28/h4-10,12-14,16,18,20-21,25,31H,11,15,17,19H2,1-3H3/q+2 |
| InChIKey | SRWZRYNLUCAKMZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|