About [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium
[3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium (PubChem CID 149068064) has the molecular formula C11H7Br2INO2+
and a molecular weight of 471.89 g/mol. Its IUPAC name is [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium.
Molecular Properties
| Compound Name | [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium |
| PubChem CID | 149068064 |
| Molecular Formula | C11H7Br2INO2+ |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 469.79 |
| IUPAC Name | [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium |
| SMILES | O=C1C(Br)=C(Br)C(=O)N1Cc1cccc([IH+])c1 |
| InChI | InChI=1S/C11H7Br2INO2/c12-8-9(13)11(17)15(10(8)16)5-6-2-1-3-7(14)4-6/h1-4,14H,5H2/q+1 |
| InChIKey | QNFSIICDQQRFGO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium?
The IUPAC name of [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium (CID 149068064) is [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium.
What is the SMILES notation for [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium?
The canonical SMILES for [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium is O=C1C(Br)=C(Br)C(=O)N1Cc1cccc([IH+])c1.
What is the InChIKey of [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium?
The InChIKey is QNFSIICDQQRFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Br2INO2/c12-8-9(13)11(17)15(10(8)16)5-6-2-1-3-7(14)4-6/h1-4,14H,5H2/q+1.
What are the key properties of [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium?
[3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium has a molecular weight of 471.89 g/mol, XLogP of -0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,4-dibromo-2,5-dioxopyrrol-1-yl)methyl]phenyl]iodanium is sourced from PubChem (CID 149068064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).