About 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione
3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 14906879) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione.
Molecular Properties
| Compound Name | 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| PubChem CID | 14906879 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | CC(C)=C1C(=O)OC2(CCCCC2)OC1=O |
| InChI | InChI=1S/C12H16O4/c1-8(2)9-10(13)15-12(16-11(9)14)6-4-3-5-7-12/h3-7H2,1-2H3 |
| InChIKey | OYFGUIHODWOEMK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The IUPAC name of 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione (CID 14906879) is 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione.
What is the SMILES notation for 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The canonical SMILES for 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione is CC(C)=C1C(=O)OC2(CCCCC2)OC1=O.
What is the InChIKey of 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The InChIKey is OYFGUIHODWOEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-8(2)9-10(13)15-12(16-11(9)14)6-4-3-5-7-12/h3-7H2,1-2H3.
What are the key properties of 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione?
3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione has a molecular weight of 224.26 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione is sourced from PubChem (CID 14906879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).