C55H40N2 — CID 149072104
3-[4-[3-(3,5-diphenylphenyl)-10-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]anthracen-9-yl]phenyl]-5-methylpyridine (PubChem CID 149072104) has the molecular formula C55H40N2 and a molecular weight of 728.94 g/mol. Its IUPAC name is 3-[4-[3-(3,5-diphenylphenyl)-10-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]anthracen-9-yl]phenyl]-5-methylpyridine.
| Compound Name | 3-[4-[3-(3,5-diphenylphenyl)-10-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]anthracen-9-yl]phenyl]-5-methylpyridine |
|---|---|
| PubChem CID | 149072104 |
| Molecular Formula | C55H40N2 |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | 3-[4-[3-(3,5-diphenylphenyl)-10-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]anthracen-9-yl]phenyl]-5-methylpyridine |
| SMILES | Cc1cncc(-c2ccc(-c3c4ccccc4c(-c4ccc(-c5c[nH]c(C)c5)cc4)c4cc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)ccc34)cc2)c1 |
| InChI | InChI=1S/C55H40N2/c1-36-27-48(34-56-33-36)40-17-21-42(22-18-40)54-50-15-9-10-16-51(50)55(43-23-19-41(20-24-43)49-28-37(2)57-35-49)53-32-44(25-26-52(53)54)47-30-45(38-11-5-3-6-12-38)29-46(31-47)39-13-7-4-8-14-39/h3-35,57H,1-2H3 |
| InChIKey | QOEQUVGRLFFCPX-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|