C32H38F2N4O2 — CID 149073169
N-[4-amino-1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-N-(4-methoxyphenyl)-2-methyl-4-piperidin-1-ylbenzamide (PubChem CID 149073169) has the molecular formula C32H38F2N4O2 and a molecular weight of 548.68 g/mol. Its IUPAC name is N-[4-amino-1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-N-(4-methoxyphenyl)-2-methyl-4-piperidin-1-ylbenzamide.
| Compound Name | N-[4-amino-1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-N-(4-methoxyphenyl)-2-methyl-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 149073169 |
| Molecular Formula | C32H38F2N4O2 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | N-[4-amino-1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-N-(4-methoxyphenyl)-2-methyl-4-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(N(C(=O)c2ccc(N3CCCCC3)cc2C)C2(N)CCN(Cc3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C32H38F2N4O2/c1-23-20-26(37-16-4-3-5-17-37)9-12-28(23)31(39)38(25-7-10-27(40-2)11-8-25)32(35)14-18-36(19-15-32)22-24-6-13-29(33)30(34)21-24/h6-13,20-21H,3-5,14-19,22,35H2,1-2H3 |
| InChIKey | QOJRXOLBSUCDIN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|