About 2-(2-ethylphenyl)ethanol
2-(2-ethylphenyl)ethanol (PubChem CID 14907447) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(2-ethylphenyl)ethanol.
Molecular Properties
| Compound Name | 2-(2-ethylphenyl)ethanol |
| PubChem CID | 14907447 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(2-ethylphenyl)ethanol |
| SMILES | CCc1ccccc1CCO |
| InChI | InChI=1S/C10H14O/c1-2-9-5-3-4-6-10(9)7-8-11/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | IQHHLQVUUXLKFL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-ethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylphenyl)ethanol?
The IUPAC name of 2-(2-ethylphenyl)ethanol (CID 14907447) is 2-(2-ethylphenyl)ethanol.
What is the SMILES notation for 2-(2-ethylphenyl)ethanol?
The canonical SMILES for 2-(2-ethylphenyl)ethanol is CCc1ccccc1CCO.
What is the InChIKey of 2-(2-ethylphenyl)ethanol?
The InChIKey is IQHHLQVUUXLKFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-2-9-5-3-4-6-10(9)7-8-11/h3-6,11H,2,7-8H2,1H3.
What are the key properties of 2-(2-ethylphenyl)ethanol?
2-(2-ethylphenyl)ethanol has a molecular weight of 150.22 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylphenyl)ethanol is sourced from PubChem (CID 14907447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).