About 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal
9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal (PubChem CID 14907556) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal.
Molecular Properties
| Compound Name | 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal |
| PubChem CID | 14907556 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal |
| SMILES | O=CCCCCCCCCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C15H20O3/c16-11-7-5-3-1-2-4-6-8-13-12-14(17)9-10-15(13)18/h9-12H,1-8H2 |
| InChIKey | SDQOJLFHGJABDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal?
The IUPAC name of 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal (CID 14907556) is 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal.
What is the SMILES notation for 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal?
The canonical SMILES for 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal is O=CCCCCCCCCC1=CC(=O)C=CC1=O.
What is the InChIKey of 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal?
The InChIKey is SDQOJLFHGJABDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c16-11-7-5-3-1-2-4-6-8-13-12-14(17)9-10-15(13)18/h9-12H,1-8H2.
What are the key properties of 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal?
9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal has a molecular weight of 248.32 g/mol, XLogP of 2.94, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,6-dioxocyclohexa-1,4-dien-1-yl)nonanal is sourced from PubChem (CID 14907556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).