About 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide
2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide (PubChem CID 149083158) has the molecular formula C16H11N3O2S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide.
Molecular Properties
| Compound Name | 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide |
| PubChem CID | 149083158 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide |
| SMILES | NC(=O)c1cc(-c2cn3c(n2)sc2ccccc23)ccc1O |
| InChI | InChI=1S/C16H11N3O2S/c17-15(21)10-7-9(5-6-13(10)20)11-8-19-12-3-1-2-4-14(12)22-16(19)18-11/h1-8,20H,(H2,17,21) |
| InChIKey | QQSRYCNXQQCSIY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide?
The IUPAC name of 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide (CID 149083158) is 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide.
What is the SMILES notation for 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide?
The canonical SMILES for 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide is NC(=O)c1cc(-c2cn3c(n2)sc2ccccc23)ccc1O.
What is the InChIKey of 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide?
The InChIKey is QQSRYCNXQQCSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2S/c17-15(21)10-7-9(5-6-13(10)20)11-8-19-12-3-1-2-4-14(12)22-16(19)18-11/h1-8,20H,(H2,17,21).
What are the key properties of 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide?
2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide has a molecular weight of 309.35 g/mol, XLogP of 3.02, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzamide is sourced from PubChem (CID 149083158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).