About CID 149088614
CID 149088614 (PubChem CID 149088614) has the molecular formula C29H32F6IN2O8S-
and a molecular weight of 809.54 g/mol.
Molecular Properties
| Compound Name | CID 149088614 |
| PubChem CID | 149088614 |
| Molecular Formula | C29H32F6IN2O8S- |
| Molecular Weight | 809.54 g/mol |
| Exact Mass | 809.08 |
| IUPAC Name | — |
| SMILES | CCO[I-](OCC)(OCC)SCCCNC(=O)c1cc(C(c2ccc3c(c2)C(=O)N(C)C3=O)(C(F)(F)F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C29H32F6IN2O8S/c1-5-44-36(45-6-2,46-7-3)47-14-8-13-37-23(39)21-15-17(10-12-20(21)26(42)43)27(28(30,31)32,29(33,34)35)18-9-11-19-22(16-18)25(41)38(4)24(19)40/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,37,39)(H,42,43)/q-1 |
| InChIKey | PIAYLKXBGGIMPN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 809.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 149088614 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149088614?
The IUPAC name of CID 149088614 (CID 149088614) is not available.
What is the SMILES notation for CID 149088614?
The canonical SMILES for CID 149088614 is CCO[I-](OCC)(OCC)SCCCNC(=O)c1cc(C(c2ccc3c(c2)C(=O)N(C)C3=O)(C(F)(F)F)C(F)(F)F)ccc1C(=O)O.
What is the InChIKey of CID 149088614?
The InChIKey is PIAYLKXBGGIMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32F6IN2O8S/c1-5-44-36(45-6-2,46-7-3)47-14-8-13-37-23(39)21-15-17(10-12-20(21)26(42)43)27(28(30,31)32,29(33,34)35)18-9-11-19-22(16-18)25(41)38(4)24(19)40/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,37,39)(H,42,43)/q-1.
What are the key properties of CID 149088614?
CID 149088614 has a molecular weight of 809.54 g/mol, XLogP of 2.80, 15 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149088614 is sourced from PubChem (CID 149088614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).