C17H13F2N3O5 — CID 149089839
methyl 2-aminooxy-1-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzimidazole-5-carboxylate (PubChem CID 149089839) has the molecular formula C17H13F2N3O5 and a molecular weight of 377.30 g/mol. Its IUPAC name is methyl 2-aminooxy-1-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-aminooxy-1-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 149089839 |
| Molecular Formula | C17H13F2N3O5 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | methyl 2-aminooxy-1-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(ON)n2Cc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C17H13F2N3O5/c1-24-15(23)9-5-6-12-11(7-9)21-16(27-20)22(12)8-10-3-2-4-13-14(10)26-17(18,19)25-13/h2-7H,8,20H2,1H3 |
| InChIKey | QRYWEAXZXGMBLS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|