C12H21BF3N3O5 — CID 149090967
(3R)-3-amino-1-(2-amino-4,4,4-trifluorobutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 149090967) has the molecular formula C12H21BF3N3O5 and a molecular weight of 355.12 g/mol. Its IUPAC name is (3R)-3-amino-1-(2-amino-4,4,4-trifluorobutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-3-amino-1-(2-amino-4,4,4-trifluorobutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 149090967 |
| Molecular Formula | C12H21BF3N3O5 |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (3R)-3-amino-1-(2-amino-4,4,4-trifluorobutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(CC(F)(F)F)C(=O)N1CC(CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H21BF3N3O5/c14-12(15,16)4-8(17)9(20)19-5-7(2-1-3-13(23)24)11(18,6-19)10(21)22/h7-8,23-24H,1-6,17-18H2,(H,21,22)/t7?,8?,11-/m0/s1 |
| InChIKey | QSJCIJFXCATKPM-AYVLWNQUSA-N |
| XLogP | -1.24 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|