C36H46ClN3O8S — CID 149091314
1-[2-[2-[4-chloro-3-[2-[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]ethyl]phenyl]sulfanylethoxy]ethyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea (PubChem CID 149091314) has the molecular formula C36H46ClN3O8S and a molecular weight of 716.30 g/mol. Its IUPAC name is 1-[2-[2-[4-chloro-3-[2-[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]ethyl]phenyl]sulfanylethoxy]ethyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea.
| Compound Name | 1-[2-[2-[4-chloro-3-[2-[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]ethyl]phenyl]sulfanylethoxy]ethyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
|---|---|
| PubChem CID | 149091314 |
| Molecular Formula | C36H46ClN3O8S |
| Molecular Weight | 716.30 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 1-[2-[2-[4-chloro-3-[2-[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]ethyl]phenyl]sulfanylethoxy]ethyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
| SMILES | O=C(NCCOCCSc1ccc(Cl)c(CCC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C36H46ClN3O8S/c37-29-8-7-25(49-18-17-47-16-15-39-35(46)40-21-30(42)33(44)34(45)31(43)22-41)19-23(29)9-11-36(12-13-36)28-20-38-14-10-26(28)27-3-1-2-4-32(27)48-24-5-6-24/h1-4,7-8,10,14,19-20,24,30-31,33-34,41-45H,5-6,9,11-13,15-18,21-22H2,(H2,39,40,46)/t30-,31+,33+,34+/m0/s1 |
| InChIKey | QSKWNHXKQXKHPB-WVBWOMQXSA-N |
| XLogP | 3.45 |
| TPSA | 173.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|