C20H18N2 — CID 14909209
N,3-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-amine (PubChem CID 14909209) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N,3-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-amine.
| Compound Name | N,3-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-amine |
|---|---|
| PubChem CID | 14909209 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N,3-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-amine |
| SMILES | c1ccc(Nc2nc(-c3ccccc3)cc3c2CCC3)cc1 |
| InChI | InChI=1S/C20H18N2/c1-3-8-15(9-4-1)19-14-16-10-7-13-18(16)20(22-19)21-17-11-5-2-6-12-17/h1-6,8-9,11-12,14H,7,10,13H2,(H,21,22) |
| InChIKey | QPXMGAAUGANKBV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |