About 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine
2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine (PubChem CID 149092451) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine |
| PubChem CID | 149092451 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)(C)OC/C=C/C(C)(F)F |
| InChI | InChI=1S/C10H19F2NO/c1-9(2,8-13-4)14-7-5-6-10(3,11)12/h5-6,13H,7-8H2,1-4H3/b6-5+ |
| InChIKey | QSQUIDMAZNDYRC-AATRIKPKSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine?
The IUPAC name of 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine (CID 149092451) is 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine?
The canonical SMILES for 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine is CNCC(C)(C)OC/C=C/C(C)(F)F.
What is the InChIKey of 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine?
The InChIKey is QSQUIDMAZNDYRC-AATRIKPKSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-9(2,8-13-4)14-7-5-6-10(3,11)12/h5-6,13H,7-8H2,1-4H3/b6-5+.
What are the key properties of 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine?
2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine has a molecular weight of 207.26 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4,4-difluoropent-2-enoxy]-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 149092451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).