C20H14F6I2O7S2 — CID 14909246
[phenyl-[(1R,4S)-3-[phenyl(trifluoromethylsulfonyloxy)-lambda3-iodanyl]-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-lambda3-iodanyl] trifluoromethanesulfonate (PubChem CID 14909246) has the molecular formula C20H14F6I2O7S2 and a molecular weight of 798.25 g/mol. Its IUPAC name is [phenyl-[(1R,4S)-3-[phenyl(trifluoromethylsulfonyloxy)-lambda3-iodanyl]-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-lambda3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [phenyl-[(1R,4S)-3-[phenyl(trifluoromethylsulfonyloxy)-lambda3-iodanyl]-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-lambda3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14909246 |
| Molecular Formula | C20H14F6I2O7S2 |
| Molecular Weight | 798.25 g/mol |
| Exact Mass | 797.82 |
| IUPAC Name | [phenyl-[(1R,4S)-3-[phenyl(trifluoromethylsulfonyloxy)-lambda3-iodanyl]-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-lambda3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(C1=C(I(OS(=O)(=O)C(F)(F)F)c2ccccc2)[C@H]2C=C[C@@H]1O2)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H14F6I2O7S2/c21-19(22,23)36(29,30)34-27(13-7-3-1-4-8-13)17-15-11-12-16(33-15)18(17)28(14-9-5-2-6-10-14)35-37(31,32)20(24,25)26/h1-12,15-16H/t15-,16+ |
| InChIKey | SPGBUCVYAWEHDG-IYBDPMFKSA-N |
| XLogP | 5.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.25 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|