C10H17NO2 — CID 149093719
spiro[1,2,3,3a,4,5,7,7a-octahydroisoindole-6,2'-1,3-dioxolane] (PubChem CID 149093719) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is spiro[1,2,3,3a,4,5,7,7a-octahydroisoindole-6,2'-1,3-dioxolane].
| Compound Name | spiro[1,2,3,3a,4,5,7,7a-octahydroisoindole-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 149093719 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | spiro[1,2,3,3a,4,5,7,7a-octahydroisoindole-6,2'-1,3-dioxolane] |
| SMILES | C1COC2(CCC3CNCC3C2)O1 |
| InChI | InChI=1S/C10H17NO2/c1-2-10(12-3-4-13-10)5-9-7-11-6-8(1)9/h8-9,11H,1-7H2 |
| InChIKey | QSZPFEDJYFVANT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |