C23H24N2O3 — CID 149096380
1-[3-[3-(furan-2-yl)-5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]but-3-en-2-one (PubChem CID 149096380) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[3-[3-(furan-2-yl)-5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]but-3-en-2-one.
| Compound Name | 1-[3-[3-(furan-2-yl)-5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 149096380 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[3-[3-(furan-2-yl)-5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1CCC=C(c2c(COC)cnc3[nH]cc(-c4ccco4)c23)C1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-18(26)11-15-6-4-7-16(10-15)21-17(14-27-2)12-24-23-22(21)19(13-25-23)20-8-5-9-28-20/h3,5,7-9,12-13,15H,1,4,6,10-11,14H2,2H3,(H,24,25) |
| InChIKey | QTRLATQQZPGHGQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|