About 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione
1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione (PubChem CID 149098219) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione.
Molecular Properties
| Compound Name | 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione |
| PubChem CID | 149098219 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione |
| SMILES | COC[C@@H]1C[C@@H](C)CN1C(=O)CCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C20H37NO3/c1-17-14-19(16-24-3)21(15-17)20(23)13-11-9-7-5-4-6-8-10-12-18(2)22/h17,19H,4-16H2,1-3H3/t17-,19+/m1/s1 |
| InChIKey | QUAGXOSFPGZRGV-MJGOQNOKSA-N |
| XLogP | 4.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione?
The IUPAC name of 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione (CID 149098219) is 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione.
What is the SMILES notation for 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione?
The canonical SMILES for 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione is COC[C@@H]1C[C@@H](C)CN1C(=O)CCCCCCCCCCC(C)=O.
What is the InChIKey of 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione?
The InChIKey is QUAGXOSFPGZRGV-MJGOQNOKSA-N. The full InChI is InChI=1S/C20H37NO3/c1-17-14-19(16-24-3)21(15-17)20(23)13-11-9-7-5-4-6-8-10-12-18(2)22/h17,19H,4-16H2,1-3H3/t17-,19+/m1/s1.
What are the key properties of 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione?
1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione has a molecular weight of 339.52 g/mol, XLogP of 4.36, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4R)-2-(methoxymethyl)-4-methylpyrrolidin-1-yl]tridecane-1,12-dione is sourced from PubChem (CID 149098219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).