C27H22FIN2O4 — CID 149098720
3-[6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]benzamide (PubChem CID 149098720) has the molecular formula C27H22FIN2O4 and a molecular weight of 584.39 g/mol. Its IUPAC name is 3-[6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]benzamide.
| Compound Name | 3-[6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]benzamide |
|---|---|
| PubChem CID | 149098720 |
| Molecular Formula | C27H22FIN2O4 |
| Molecular Weight | 584.39 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | 3-[6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]benzamide |
| SMILES | Cc1c(Cc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(C)c(-c3cccc(C(N)=O)c3)c2oc1=O |
| InChI | InChI=1S/C27H22FIN2O4/c1-13-20(11-15-6-7-18(29)12-21(15)28)23-24(35-27(13)34)22(14(2)31(26(23)33)19-8-9-19)16-4-3-5-17(10-16)25(30)32/h3-7,10,12,19H,8-9,11H2,1-2H3,(H2,30,32) |
| InChIKey | QUCQVGNLUYWFNE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|