About 4,4-difluorobutylbenzene
4,4-difluorobutylbenzene (PubChem CID 14909953) has the molecular formula C10H12F2
and a molecular weight of 170.20 g/mol. Its IUPAC name is 4,4-difluorobutylbenzene.
Molecular Properties
| Compound Name | 4,4-difluorobutylbenzene |
| PubChem CID | 14909953 |
| Molecular Formula | C10H12F2 |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4,4-difluorobutylbenzene |
| SMILES | FC(F)CCCc1ccccc1 |
| InChI | InChI=1S/C10H12F2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | OKGZHVLJQPXHQR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,4-difluorobutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorobutylbenzene?
The IUPAC name of 4,4-difluorobutylbenzene (CID 14909953) is 4,4-difluorobutylbenzene.
What is the SMILES notation for 4,4-difluorobutylbenzene?
The canonical SMILES for 4,4-difluorobutylbenzene is FC(F)CCCc1ccccc1.
What is the InChIKey of 4,4-difluorobutylbenzene?
The InChIKey is OKGZHVLJQPXHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2.
What are the key properties of 4,4-difluorobutylbenzene?
4,4-difluorobutylbenzene has a molecular weight of 170.20 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorobutylbenzene is sourced from PubChem (CID 14909953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).