About 4-(difluoromethyl)octane
4-(difluoromethyl)octane (PubChem CID 14909954) has the molecular formula C9H18F2
and a molecular weight of 164.24 g/mol. Its IUPAC name is 4-(difluoromethyl)octane.
Molecular Properties
| Compound Name | 4-(difluoromethyl)octane |
| PubChem CID | 14909954 |
| Molecular Formula | C9H18F2 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | 4-(difluoromethyl)octane |
| SMILES | CCCCC(CCC)C(F)F |
| InChI | InChI=1S/C9H18F2/c1-3-5-7-8(6-4-2)9(10)11/h8-9H,3-7H2,1-2H3 |
| InChIKey | NRNBMPYTBLAGDC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(difluoromethyl)octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)octane?
The IUPAC name of 4-(difluoromethyl)octane (CID 14909954) is 4-(difluoromethyl)octane.
What is the SMILES notation for 4-(difluoromethyl)octane?
The canonical SMILES for 4-(difluoromethyl)octane is CCCCC(CCC)C(F)F.
What is the InChIKey of 4-(difluoromethyl)octane?
The InChIKey is NRNBMPYTBLAGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2/c1-3-5-7-8(6-4-2)9(10)11/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-(difluoromethyl)octane?
4-(difluoromethyl)octane has a molecular weight of 164.24 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)octane is sourced from PubChem (CID 14909954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).