C18H19FO3 — CID 149101214
(1S,4S,5S,13R,17R)-10-fluoro-17-hydroxy-4-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one (PubChem CID 149101214) has the molecular formula C18H19FO3 and a molecular weight of 302.34 g/mol. Its IUPAC name is (1S,4S,5S,13R,17R)-10-fluoro-17-hydroxy-4-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one.
| Compound Name | (1S,4S,5S,13R,17R)-10-fluoro-17-hydroxy-4-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one |
|---|---|
| PubChem CID | 149101214 |
| Molecular Formula | C18H19FO3 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1S,4S,5S,13R,17R)-10-fluoro-17-hydroxy-4-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one |
| SMILES | C[C@H]1CC[C@]23c4c5ccc(F)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C18H19FO3/c1-9-4-6-17-14-10-2-3-12(19)15(14)22-16(17)13(20)5-7-18(17,21)11(9)8-10/h2-3,9,11,16,21H,4-8H2,1H3/t9-,11-,16-,17-,18+/m0/s1 |
| InChIKey | QUQZCBDQXOMGCW-ZWJGULQVSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |