About 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one
4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one (PubChem CID 149101547) has the molecular formula C22H23N3O2
and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one.
Molecular Properties
| Compound Name | 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one |
| PubChem CID | 149101547 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)CN1c1ccccc1OCC(C)C |
| InChI | InChI=1S/C22H23N3O2/c1-14(2)13-27-20-10-6-5-9-18(20)25-12-19(26)21(22(25)23)17-11-15-7-3-4-8-16(15)24-17/h3-10,14,23-24H,11-13H2,1-2H3/b21-17?,23-22- |
| InChIKey | BMWUJYMBJJPRCW-RSSAHXBPSA-N |
| XLogP | 4.01 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one?
The IUPAC name of 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one (CID 149101547) is 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one.
What is the SMILES notation for 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one?
The canonical SMILES for 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one is [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)CN1c1ccccc1OCC(C)C.
What is the InChIKey of 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one?
The InChIKey is BMWUJYMBJJPRCW-RSSAHXBPSA-N. The full InChI is InChI=1S/C22H23N3O2/c1-14(2)13-27-20-10-6-5-9-18(20)25-12-19(26)21(22(25)23)17-11-15-7-3-4-8-16(15)24-17/h3-10,14,23-24H,11-13H2,1-2H3/b21-17?,23-22-.
What are the key properties of 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one?
4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one has a molecular weight of 361.45 g/mol, XLogP of 4.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dihydroindol-2-ylidene)-5-imino-1-[2-(2-methylpropoxy)phenyl]pyrrolidin-3-one is sourced from PubChem (CID 149101547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).