C13H18N2O2 — CID 14910467
3-hydroperoxy-3,4,4,5-tetramethyl-5-phenylpyrazole (PubChem CID 14910467) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-hydroperoxy-3,4,4,5-tetramethyl-5-phenylpyrazole.
| Compound Name | 3-hydroperoxy-3,4,4,5-tetramethyl-5-phenylpyrazole |
|---|---|
| PubChem CID | 14910467 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-hydroperoxy-3,4,4,5-tetramethyl-5-phenylpyrazole |
| SMILES | CC1(OO)N=NC(C)(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C13H18N2O2/c1-11(2)12(3,10-8-6-5-7-9-10)14-15-13(11,4)17-16/h5-9,16H,1-4H3 |
| InChIKey | CAPYKRCIYGZPAM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|