About 4-chloro-2,5-dimethylbenzenesulfonic acid
4-chloro-2,5-dimethylbenzenesulfonic acid (PubChem CID 14910662) has the molecular formula C8H9ClO3S
and a molecular weight of 220.68 g/mol. Its IUPAC name is 4-chloro-2,5-dimethylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 4-chloro-2,5-dimethylbenzenesulfonic acid |
| PubChem CID | 14910662 |
| Molecular Formula | C8H9ClO3S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 4-chloro-2,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C)cc1Cl |
| InChI | InChI=1S/C8H9ClO3S/c1-5-4-8(13(10,11)12)6(2)3-7(5)9/h3-4H,1-2H3,(H,10,11,12) |
| InChIKey | HVHSOHIAMACROZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,5-dimethylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,5-dimethylbenzenesulfonic acid?
The IUPAC name of 4-chloro-2,5-dimethylbenzenesulfonic acid (CID 14910662) is 4-chloro-2,5-dimethylbenzenesulfonic acid.
What is the SMILES notation for 4-chloro-2,5-dimethylbenzenesulfonic acid?
The canonical SMILES for 4-chloro-2,5-dimethylbenzenesulfonic acid is Cc1cc(S(=O)(=O)O)c(C)cc1Cl.
What is the InChIKey of 4-chloro-2,5-dimethylbenzenesulfonic acid?
The InChIKey is HVHSOHIAMACROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO3S/c1-5-4-8(13(10,11)12)6(2)3-7(5)9/h3-4H,1-2H3,(H,10,11,12).
What are the key properties of 4-chloro-2,5-dimethylbenzenesulfonic acid?
4-chloro-2,5-dimethylbenzenesulfonic acid has a molecular weight of 220.68 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,5-dimethylbenzenesulfonic acid is sourced from PubChem (CID 14910662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).