C16H17NO4 — CID 14910849
ethyl 4,5-dioxo-1,2,3,6,7,8-hexahydroacridine-9-carboxylate (PubChem CID 14910849) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 4,5-dioxo-1,2,3,6,7,8-hexahydroacridine-9-carboxylate.
| Compound Name | ethyl 4,5-dioxo-1,2,3,6,7,8-hexahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 14910849 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 4,5-dioxo-1,2,3,6,7,8-hexahydroacridine-9-carboxylate |
| SMILES | CCOC(=O)c1c2c(nc3c1CCCC3=O)C(=O)CCC2 |
| InChI | InChI=1S/C16H17NO4/c1-2-21-16(20)13-9-5-3-7-11(18)14(9)17-15-10(13)6-4-8-12(15)19/h2-8H2,1H3 |
| InChIKey | ZPJLOGNNHNFINA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |