C18H21N3O5S — CID 149109081
(4R)-2-acetyl-4-amino-N-[(1R)-1-(6-oxo-4-prop-2-ynoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 149109081) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is (4R)-2-acetyl-4-amino-N-[(1R)-1-(6-oxo-4-prop-2-ynoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-acetyl-4-amino-N-[(1R)-1-(6-oxo-4-prop-2-ynoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 149109081 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (4R)-2-acetyl-4-amino-N-[(1R)-1-(6-oxo-4-prop-2-ynoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | C#CCOc1cc([C@@H](CCC)NC(=O)[C@]2(N)CSC(C(C)=O)=N2)oc(=O)c1 |
| InChI | InChI=1S/C18H21N3O5S/c1-4-6-13(14-8-12(25-7-5-2)9-15(23)26-14)20-17(24)18(19)10-27-16(21-18)11(3)22/h2,8-9,13H,4,6-7,10,19H2,1,3H3,(H,20,24)/t13-,18+/m1/s1 |
| InChIKey | QWKRNRWUPKUXOE-ACJLOTCBSA-N |
| XLogP | 1.00 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|