C33H22F6N2O10S2 — CID 149109902
2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-3-oxo-1H-isoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid (PubChem CID 149109902) has the molecular formula C33H22F6N2O10S2 and a molecular weight of 784.66 g/mol. Its IUPAC name is 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-3-oxo-1H-isoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-3-oxo-1H-isoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 149109902 |
| Molecular Formula | C33H22F6N2O10S2 |
| Molecular Weight | 784.66 g/mol |
| Exact Mass | 784.06 |
| IUPAC Name | 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-3-oxo-1H-isoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Oc2ccc(N3Cc4cc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)ccc4C3=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C33H22F6N2O10S2/c1-16-3-9-24(26(11-16)52(45,46)47)51-25-10-6-20(14-27(25)53(48,49)50)41-15-17-12-18(4-7-21(17)30(41)44)31(32(34,35)36,33(37,38)39)19-5-8-22-23(13-19)29(43)40(2)28(22)42/h3-14H,15H2,1-2H3,(H,45,46,47)(H,48,49,50) |
| InChIKey | QWRATZZTUZMPAL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|