C19H19FO4 — CID 149110137
2-[4-(4-fluorophenyl)-4-tetracyclo[5.2.1.03,8.05,8]decanyl]propanedioic acid (PubChem CID 149110137) has the molecular formula C19H19FO4 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-4-tetracyclo[5.2.1.03,8.05,8]decanyl]propanedioic acid.
| Compound Name | 2-[4-(4-fluorophenyl)-4-tetracyclo[5.2.1.03,8.05,8]decanyl]propanedioic acid |
|---|---|
| PubChem CID | 149110137 |
| Molecular Formula | C19H19FO4 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-4-tetracyclo[5.2.1.03,8.05,8]decanyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)C1(c2ccc(F)cc2)C2CC3CC4CC1C42C3 |
| InChI | InChI=1S/C19H19FO4/c20-12-3-1-10(2-4-12)19(15(16(21)22)17(23)24)13-6-9-5-11-7-14(19)18(11,13)8-9/h1-4,9,11,13-15H,5-8H2,(H,21,22)(H,23,24) |
| InChIKey | QWSHWQRXXGXIEL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|