About 2-(cyclopenten-1-yl)-1,4-difluorobenzene
2-(cyclopenten-1-yl)-1,4-difluorobenzene (PubChem CID 149112828) has the molecular formula C11H10F2
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-1,4-difluorobenzene.
Molecular Properties
| Compound Name | 2-(cyclopenten-1-yl)-1,4-difluorobenzene |
| PubChem CID | 149112828 |
| Molecular Formula | C11H10F2 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(cyclopenten-1-yl)-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(C2=CCCC2)c1 |
| InChI | InChI=1S/C11H10F2/c12-9-5-6-11(13)10(7-9)8-3-1-2-4-8/h3,5-7H,1-2,4H2 |
| InChIKey | QXPJOYLFIRUIOW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(cyclopenten-1-yl)-1,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenten-1-yl)-1,4-difluorobenzene?
The IUPAC name of 2-(cyclopenten-1-yl)-1,4-difluorobenzene (CID 149112828) is 2-(cyclopenten-1-yl)-1,4-difluorobenzene.
What is the SMILES notation for 2-(cyclopenten-1-yl)-1,4-difluorobenzene?
The canonical SMILES for 2-(cyclopenten-1-yl)-1,4-difluorobenzene is Fc1ccc(F)c(C2=CCCC2)c1.
What is the InChIKey of 2-(cyclopenten-1-yl)-1,4-difluorobenzene?
The InChIKey is QXPJOYLFIRUIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2/c12-9-5-6-11(13)10(7-9)8-3-1-2-4-8/h3,5-7H,1-2,4H2.
What are the key properties of 2-(cyclopenten-1-yl)-1,4-difluorobenzene?
2-(cyclopenten-1-yl)-1,4-difluorobenzene has a molecular weight of 180.20 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenten-1-yl)-1,4-difluorobenzene is sourced from PubChem (CID 149112828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).