About N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine
N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine (PubChem CID 149117587) has the molecular formula C11H17F3N2
and a molecular weight of 234.26 g/mol. Its IUPAC name is N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine.
Molecular Properties
| Compound Name | N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine |
| PubChem CID | 149117587 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine |
| SMILES | C=C/C=C(/NC1CNCC(F)C1)C(C)(F)F |
| InChI | InChI=1S/C11H17F3N2/c1-3-4-10(11(2,13)14)16-9-5-8(12)6-15-7-9/h3-4,8-9,15-16H,1,5-7H2,2H3/b10-4+ |
| InChIKey | QYWHYLYUQGAPIW-ONNFQVAWSA-N |
| XLogP | 2.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine?
The IUPAC name of N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine (CID 149117587) is N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine.
What is the SMILES notation for N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine?
The canonical SMILES for N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine is C=C/C=C(/NC1CNCC(F)C1)C(C)(F)F.
What is the InChIKey of N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine?
The InChIKey is QYWHYLYUQGAPIW-ONNFQVAWSA-N. The full InChI is InChI=1S/C11H17F3N2/c1-3-4-10(11(2,13)14)16-9-5-8(12)6-15-7-9/h3-4,8-9,15-16H,1,5-7H2,2H3/b10-4+.
What are the key properties of N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine?
N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine has a molecular weight of 234.26 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-2,2-difluorohexa-3,5-dien-3-yl]-5-fluoropiperidin-3-amine is sourced from PubChem (CID 149117587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).