About 2,4-dioxopentan-3-yl piperidine-1-carbodithioate
2,4-dioxopentan-3-yl piperidine-1-carbodithioate (PubChem CID 14912149) has the molecular formula C11H17NO2S2
and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,4-dioxopentan-3-yl piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | 2,4-dioxopentan-3-yl piperidine-1-carbodithioate |
| PubChem CID | 14912149 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,4-dioxopentan-3-yl piperidine-1-carbodithioate |
| SMILES | CC(=O)C(SC(=S)N1CCCCC1)C(C)=O |
| InChI | InChI=1S/C11H17NO2S2/c1-8(13)10(9(2)14)16-11(15)12-6-4-3-5-7-12/h10H,3-7H2,1-2H3 |
| InChIKey | IIJYGZKQRZIAFT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dioxopentan-3-yl piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxopentan-3-yl piperidine-1-carbodithioate?
The IUPAC name of 2,4-dioxopentan-3-yl piperidine-1-carbodithioate (CID 14912149) is 2,4-dioxopentan-3-yl piperidine-1-carbodithioate.
What is the SMILES notation for 2,4-dioxopentan-3-yl piperidine-1-carbodithioate?
The canonical SMILES for 2,4-dioxopentan-3-yl piperidine-1-carbodithioate is CC(=O)C(SC(=S)N1CCCCC1)C(C)=O.
What is the InChIKey of 2,4-dioxopentan-3-yl piperidine-1-carbodithioate?
The InChIKey is IIJYGZKQRZIAFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S2/c1-8(13)10(9(2)14)16-11(15)12-6-4-3-5-7-12/h10H,3-7H2,1-2H3.
What are the key properties of 2,4-dioxopentan-3-yl piperidine-1-carbodithioate?
2,4-dioxopentan-3-yl piperidine-1-carbodithioate has a molecular weight of 259.40 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxopentan-3-yl piperidine-1-carbodithioate is sourced from PubChem (CID 14912149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).